C21H30O2 — CID 56647739
7,11-dimethyl-1-phenylmethoxydodec-10-en-2-yn-5-ol (PubChem CID 56647739) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 7,11-dimethyl-1-phenylmethoxydodec-10-en-2-yn-5-ol.
| Compound Name | 7,11-dimethyl-1-phenylmethoxydodec-10-en-2-yn-5-ol |
|---|---|
| PubChem CID | 56647739 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 7,11-dimethyl-1-phenylmethoxydodec-10-en-2-yn-5-ol |
| SMILES | CC(C)=CCCC(C)CC(O)CC#CCOCc1ccccc1 |
| InChI | InChI=1S/C21H30O2/c1-18(2)10-9-11-19(3)16-21(22)14-7-8-15-23-17-20-12-5-4-6-13-20/h4-6,10,12-13,19,21-22H,9,11,14-17H2,1-3H3 |
| InChIKey | CQUJJMGCOQPJFW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|