C15H18O3 — CID 10514573
8-phenylmethoxyoct-1-en-6-yne-3,5-diol (PubChem CID 10514573) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 8-phenylmethoxyoct-1-en-6-yne-3,5-diol.
| Compound Name | 8-phenylmethoxyoct-1-en-6-yne-3,5-diol |
|---|---|
| PubChem CID | 10514573 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 8-phenylmethoxyoct-1-en-6-yne-3,5-diol |
| SMILES | C=CC(O)CC(O)C#CCOCc1ccccc1 |
| InChI | InChI=1S/C15H18O3/c1-2-14(16)11-15(17)9-6-10-18-12-13-7-4-3-5-8-13/h2-5,7-8,14-17H,1,10-12H2 |
| InChIKey | SPWJNUYNHYLCBV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|