C22H32O7 — CID 10787611
[(2R,3S,5R)-2,5-dihydroxy-3-(methoxymethoxy)-8-phenylmethoxyoct-6-ynyl] 2,2-dimethylpropanoate (PubChem CID 10787611) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(2R,3S,5R)-2,5-dihydroxy-3-(methoxymethoxy)-8-phenylmethoxyoct-6-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,5R)-2,5-dihydroxy-3-(methoxymethoxy)-8-phenylmethoxyoct-6-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10787611 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(2R,3S,5R)-2,5-dihydroxy-3-(methoxymethoxy)-8-phenylmethoxyoct-6-ynyl] 2,2-dimethylpropanoate |
| SMILES | COCO[C@@H](C[C@@H](O)C#CCOCc1ccccc1)[C@H](O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H32O7/c1-22(2,3)21(25)28-15-19(24)20(29-16-26-4)13-18(23)11-8-12-27-14-17-9-6-5-7-10-17/h5-7,9-10,18-20,23-24H,12-16H2,1-4H3/t18-,19+,20-/m0/s1 |
| InChIKey | PHWRXZKWKWYCAX-ZCNNSNEGSA-N |
| XLogP | 1.90 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|