C25H40O4 — CID 11350243
[(E,2R,3R,4S,6R)-2-hydroxy-4,6,8-trimethyl-3-phenylmethoxydec-8-enyl] 2,2-dimethylpropanoate (PubChem CID 11350243) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is [(E,2R,3R,4S,6R)-2-hydroxy-4,6,8-trimethyl-3-phenylmethoxydec-8-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,2R,3R,4S,6R)-2-hydroxy-4,6,8-trimethyl-3-phenylmethoxydec-8-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11350243 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | [(E,2R,3R,4S,6R)-2-hydroxy-4,6,8-trimethyl-3-phenylmethoxydec-8-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C=C(\C)C[C@H](C)C[C@H](C)[C@@H](OCc1ccccc1)[C@H](O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H40O4/c1-8-18(2)14-19(3)15-20(4)23(28-16-21-12-10-9-11-13-21)22(26)17-29-24(27)25(5,6)7/h8-13,19-20,22-23,26H,14-17H2,1-7H3/b18-8+/t19-,20-,22+,23+/m0/s1 |
| InChIKey | VBTUSYNKEKYWMF-XJAQOGRFSA-N |
| XLogP | 5.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|