C17H24O4 — CID 134847009
2,2-dimethylpropanoyl (3R)-3-methyl-4-phenylmethoxybutanoate (PubChem CID 134847009) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl (3R)-3-methyl-4-phenylmethoxybutanoate.
| Compound Name | 2,2-dimethylpropanoyl (3R)-3-methyl-4-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 134847009 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2,2-dimethylpropanoyl (3R)-3-methyl-4-phenylmethoxybutanoate |
| SMILES | C[C@@H](COCc1ccccc1)CC(=O)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H24O4/c1-13(10-15(18)21-16(19)17(2,3)4)11-20-12-14-8-6-5-7-9-14/h5-9,13H,10-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | RWPQTIUBQMXTPP-CYBMUJFWSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|