C27H48O5Si — CID 71513942
[(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-3-phenylmethoxyheptyl] 2,2-dimethylpropanoate (PubChem CID 71513942) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-3-phenylmethoxyheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-3-phenylmethoxyheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71513942 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | [(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-3-phenylmethoxyheptyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]([C@H](OCc1ccccc1)[C@H](C)COC(=O)C(C)(C)C)[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O5Si/c1-20(18-31-25(29)26(3,4)5)24(30-19-22-14-12-11-13-15-22)21(2)23(28)16-17-32-33(9,10)27(6,7)8/h11-15,20-21,23-24,28H,16-19H2,1-10H3/t20-,21+,23-,24-/m1/s1 |
| InChIKey | SVLLDKKHMGDVEW-CBJLPSGESA-N |
| XLogP | 6.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|