C20H42O5Si — CID 71513664
[(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate (PubChem CID 71513664) has the molecular formula C20H42O5Si and a molecular weight of 390.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71513664 |
| Molecular Formula | C20H42O5Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [(2R,3R,4S,5R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]([C@H](O)[C@H](C)COC(=O)C(C)(C)C)[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O5Si/c1-14(13-24-18(23)19(3,4)5)17(22)15(2)16(21)11-12-25-26(9,10)20(6,7)8/h14-17,21-22H,11-13H2,1-10H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | OCGLQPBZTGNCLW-YYIAUSFCSA-N |
| XLogP | 3.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|