C12H26O4Si — CID 16756247
(3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhexan-2-one (PubChem CID 16756247) has the molecular formula C12H26O4Si and a molecular weight of 262.42 g/mol. Its IUPAC name is (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhexan-2-one.
| Compound Name | (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhexan-2-one |
|---|---|
| PubChem CID | 16756247 |
| Molecular Formula | C12H26O4Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhexan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O4Si/c1-9(13)11(15)10(14)7-8-16-17(5,6)12(2,3)4/h10-11,14-15H,7-8H2,1-6H3/t10-,11-/m0/s1 |
| InChIKey | NEUXIKWKRPUTFT-QWRGUYRKSA-N |
| XLogP | 1.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|