C11H22O3Si — CID 59850474
5-[tert-butyl(dimethyl)silyl]oxypentane-2,3-dione (PubChem CID 59850474) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxypentane-2,3-dione.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxypentane-2,3-dione |
|---|---|
| PubChem CID | 59850474 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxypentane-2,3-dione |
| SMILES | CC(=O)C(=O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H22O3Si/c1-9(12)10(13)7-8-14-15(5,6)11(2,3)4/h7-8H2,1-6H3 |
| InChIKey | SOLXUGXKMZYJJO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|