C11H21ClO3Si — CID 10849255
(Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoic acid (PubChem CID 10849255) has the molecular formula C11H21ClO3Si and a molecular weight of 264.82 g/mol. Its IUPAC name is (Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoic acid.
| Compound Name | (Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoic acid |
|---|---|
| PubChem CID | 10849255 |
| Molecular Formula | C11H21ClO3Si |
| Molecular Weight | 264.82 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C(Cl)=C/C(=O)O |
| InChI | InChI=1S/C11H21ClO3Si/c1-11(2,3)16(4,5)15-7-6-9(12)8-10(13)14/h8H,6-7H2,1-5H3,(H,13,14)/b9-8- |
| InChIKey | KVAINHFTBSPBLV-HJWRWDBZSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|