C13H24BrClOSi — CID 53330262
[(3E)-3-bromo-4-chlorohepta-3,6-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 53330262) has the molecular formula C13H24BrClOSi and a molecular weight of 339.78 g/mol. Its IUPAC name is [(3E)-3-bromo-4-chlorohepta-3,6-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(3E)-3-bromo-4-chlorohepta-3,6-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53330262 |
| Molecular Formula | C13H24BrClOSi |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(3E)-3-bromo-4-chlorohepta-3,6-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CC/C(Cl)=C(\Br)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24BrClOSi/c1-7-8-12(15)11(14)9-10-16-17(5,6)13(2,3)4/h7H,1,8-10H2,2-6H3/b12-11+ |
| InChIKey | BZRXBCNLWDAPPA-VAWYXSNFSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|