C15H34O2Si2 — CID 87853444
tert-butyl-dimethyl-prop-2-enoxysilane;trimethyl(prop-2-enoxy)silane (PubChem CID 87853444) has the molecular formula C15H34O2Si2 and a molecular weight of 302.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-prop-2-enoxysilane;trimethyl(prop-2-enoxy)silane.
| Compound Name | tert-butyl-dimethyl-prop-2-enoxysilane;trimethyl(prop-2-enoxy)silane |
|---|---|
| PubChem CID | 87853444 |
| Molecular Formula | C15H34O2Si2 |
| Molecular Weight | 302.61 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | tert-butyl-dimethyl-prop-2-enoxysilane;trimethyl(prop-2-enoxy)silane |
| SMILES | C=CCO[Si](C)(C)C.C=CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C9H20OSi.C6H14OSi/c1-7-8-10-11(5,6)9(2,3)4;1-5-6-7-8(2,3)4/h7H,1,8H2,2-6H3;5H,1,6H2,2-4H3 |
| InChIKey | NMQVQIZHDHKQLB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|