C9H20OSi — CID 16687272
tert-butyl-(2,3-dideuterioprop-2-enoxy)-dimethylsilane (PubChem CID 16687272) has the molecular formula C9H20OSi and a molecular weight of 174.36 g/mol. Its IUPAC name is tert-butyl-(2,3-dideuterioprop-2-enoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2,3-dideuterioprop-2-enoxy)-dimethylsilane |
|---|---|
| PubChem CID | 16687272 |
| Molecular Formula | C9H20OSi |
| Molecular Weight | 174.36 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | tert-butyl-(2,3-dideuterioprop-2-enoxy)-dimethylsilane |
| SMILES | [2H]/C=C(\[2H])CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C9H20OSi/c1-7-8-10-11(5,6)9(2,3)4/h7H,1,8H2,2-6H3/i1D,7D/b7-1+ |
| InChIKey | DHWVPYLVNAKSEU-LBZASPPUSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|