C11H16OSi — CID 100972066
2,3-dideuterioprop-2-enoxy-dimethyl-phenylsilane (PubChem CID 100972066) has the molecular formula C11H16OSi and a molecular weight of 194.35 g/mol. Its IUPAC name is 2,3-dideuterioprop-2-enoxy-dimethyl-phenylsilane.
| Compound Name | 2,3-dideuterioprop-2-enoxy-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 100972066 |
| Molecular Formula | C11H16OSi |
| Molecular Weight | 194.35 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2,3-dideuterioprop-2-enoxy-dimethyl-phenylsilane |
| SMILES | [2H]/C=C(\[2H])CO[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C11H16OSi/c1-4-10-12-13(2,3)11-8-6-5-7-9-11/h4-9H,1,10H2,2-3H3/i1D,4D/b4-1+ |
| InChIKey | UZAIMYWRLZVDEJ-PDGJVJPNSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|