C20H20OSi — CID 164533641
ethoxy-dimethyl-[4-(4-phenylbuta-1,3-diynyl)phenyl]silane (PubChem CID 164533641) has the molecular formula C20H20OSi and a molecular weight of 304.47 g/mol. Its IUPAC name is ethoxy-dimethyl-[4-(4-phenylbuta-1,3-diynyl)phenyl]silane.
| Compound Name | ethoxy-dimethyl-[4-(4-phenylbuta-1,3-diynyl)phenyl]silane |
|---|---|
| PubChem CID | 164533641 |
| Molecular Formula | C20H20OSi |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | ethoxy-dimethyl-[4-(4-phenylbuta-1,3-diynyl)phenyl]silane |
| SMILES | CCO[Si](C)(C)c1ccc(C#CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H20OSi/c1-4-21-22(2,3)20-16-14-19(15-17-20)13-9-8-12-18-10-6-5-7-11-18/h5-7,10-11,14-17H,4H2,1-3H3 |
| InChIKey | IASBGNOOLMRAOR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|