C12H22OSi2 — CID 175577251
(4-dimethylsilylphenyl)-ethoxy-dimethylsilane (PubChem CID 175577251) has the molecular formula C12H22OSi2 and a molecular weight of 238.48 g/mol. Its IUPAC name is (4-dimethylsilylphenyl)-ethoxy-dimethylsilane.
| Compound Name | (4-dimethylsilylphenyl)-ethoxy-dimethylsilane |
|---|---|
| PubChem CID | 175577251 |
| Molecular Formula | C12H22OSi2 |
| Molecular Weight | 238.48 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (4-dimethylsilylphenyl)-ethoxy-dimethylsilane |
| SMILES | CCO[Si](C)(C)c1ccc([SiH](C)C)cc1 |
| InChI | InChI=1S/C12H22OSi2/c1-6-13-15(4,5)12-9-7-11(8-10-12)14(2)3/h7-10,14H,6H2,1-5H3 |
| InChIKey | GQXXVZSLPNOTNA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|