C43H44N2OSi — CID 54503683
3-[3-(N-[4-[ethoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]-N,N-bis(4-methylphenyl)aniline (PubChem CID 54503683) has the molecular formula C43H44N2OSi and a molecular weight of 632.92 g/mol. Its IUPAC name is 3-[3-(N-[4-[ethoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]-N,N-bis(4-methylphenyl)aniline.
| Compound Name | 3-[3-(N-[4-[ethoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]-N,N-bis(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 54503683 |
| Molecular Formula | C43H44N2OSi |
| Molecular Weight | 632.92 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | 3-[3-(N-[4-[ethoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]-N,N-bis(4-methylphenyl)aniline |
| SMILES | CCO[Si](C)(C)c1ccc(N(c2ccc(C)cc2)c2cccc(-c3cccc(N(c4ccc(C)cc4)c4ccc(C)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C43H44N2OSi/c1-7-46-47(5,6)43-28-26-40(27-29-43)45(39-24-18-34(4)19-25-39)42-13-9-11-36(31-42)35-10-8-12-41(30-35)44(37-20-14-32(2)15-21-37)38-22-16-33(3)17-23-38/h8-31H,7H2,1-6H3 |
| InChIKey | YEEZMDUOYSVVLI-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.92 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|