C42H42N2OSi — CID 54214598
N-[4-[4-(N-[4-[methoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 54214598) has the molecular formula C42H42N2OSi and a molecular weight of 618.90 g/mol. Its IUPAC name is N-[4-[4-(N-[4-[methoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[4-(N-[4-[methoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 54214598 |
| Molecular Formula | C42H42N2OSi |
| Molecular Weight | 618.90 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | N-[4-[4-(N-[4-[methoxy(dimethyl)silyl]phenyl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | CO[Si](C)(C)c1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H42N2OSi/c1-31-7-17-36(18-8-31)43(37-19-9-32(2)10-20-37)39-23-13-34(14-24-39)35-15-25-40(26-16-35)44(38-21-11-33(3)12-22-38)41-27-29-42(30-28-41)46(5,6)45-4/h7-30H,1-6H3 |
| InChIKey | PYGVAYJMHUELBJ-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.90 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|