C42H42N2Si — CID 71342733
N-[4-[dimethyl-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]silyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 71342733) has the molecular formula C42H42N2Si and a molecular weight of 602.90 g/mol. Its IUPAC name is N-[4-[dimethyl-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]silyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[dimethyl-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]silyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 71342733 |
| Molecular Formula | C42H42N2Si |
| Molecular Weight | 602.90 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | N-[4-[dimethyl-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]silyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc([Si](C)(C)c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H42N2Si/c1-31-7-15-35(16-8-31)43(36-17-9-32(2)10-18-36)39-23-27-41(28-24-39)45(5,6)42-29-25-40(26-30-42)44(37-19-11-33(3)12-20-37)38-21-13-34(4)14-22-38/h7-30H,1-6H3 |
| InChIKey | WBCWETCNFTUFFD-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.90 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|