C23H27NSi — CID 23593172
N-[4-[dimethyl-(4-methylphenyl)silyl]phenyl]-N,4-dimethylaniline (PubChem CID 23593172) has the molecular formula C23H27NSi and a molecular weight of 345.56 g/mol. Its IUPAC name is N-[4-[dimethyl-(4-methylphenyl)silyl]phenyl]-N,4-dimethylaniline.
| Compound Name | N-[4-[dimethyl-(4-methylphenyl)silyl]phenyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 23593172 |
| Molecular Formula | C23H27NSi |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-[4-[dimethyl-(4-methylphenyl)silyl]phenyl]-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)c2ccc([Si](C)(C)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H27NSi/c1-18-6-10-20(11-7-18)24(3)21-12-16-23(17-13-21)25(4,5)22-14-8-19(2)9-15-22/h6-17H,1-5H3 |
| InChIKey | QPPSRKJWJDNTPM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|