C44H46N2Si — CID 23593138
N-[4-[[4-[N-(2,4-dimethylphenyl)-4-(4-methylphenyl)anilino]phenyl]-dimethylsilyl]phenyl]-N,2,4-trimethylaniline (PubChem CID 23593138) has the molecular formula C44H46N2Si and a molecular weight of 630.95 g/mol. Its IUPAC name is N-[4-[[4-[N-(2,4-dimethylphenyl)-4-(4-methylphenyl)anilino]phenyl]-dimethylsilyl]phenyl]-N,2,4-trimethylaniline.
| Compound Name | N-[4-[[4-[N-(2,4-dimethylphenyl)-4-(4-methylphenyl)anilino]phenyl]-dimethylsilyl]phenyl]-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 23593138 |
| Molecular Formula | C44H46N2Si |
| Molecular Weight | 630.95 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | N-[4-[[4-[N-(2,4-dimethylphenyl)-4-(4-methylphenyl)anilino]phenyl]-dimethylsilyl]phenyl]-N,2,4-trimethylaniline |
| SMILES | Cc1ccc(-c2ccc(N(c3ccc([Si](C)(C)c4ccc(N(C)c5ccc(C)cc5C)cc4)cc3)c3ccc(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C44H46N2Si/c1-31-9-13-36(14-10-31)37-15-17-39(18-16-37)46(44-28-12-33(3)30-35(44)5)40-21-25-42(26-22-40)47(7,8)41-23-19-38(20-24-41)45(6)43-27-11-32(2)29-34(43)4/h9-30H,1-8H3 |
| InChIKey | UKCHUTKGXPWNMF-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.95 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|