C22H25NSi — CID 23593074
4-[dimethyl-(4-methylphenyl)silyl]-N-methyl-N-phenylaniline (PubChem CID 23593074) has the molecular formula C22H25NSi and a molecular weight of 331.54 g/mol. Its IUPAC name is 4-[dimethyl-(4-methylphenyl)silyl]-N-methyl-N-phenylaniline.
| Compound Name | 4-[dimethyl-(4-methylphenyl)silyl]-N-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 23593074 |
| Molecular Formula | C22H25NSi |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-[dimethyl-(4-methylphenyl)silyl]-N-methyl-N-phenylaniline |
| SMILES | Cc1ccc([Si](C)(C)c2ccc(N(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H25NSi/c1-18-10-14-21(15-11-18)24(3,4)22-16-12-20(13-17-22)23(2)19-8-6-5-7-9-19/h5-17H,1-4H3 |
| InChIKey | PEMLFSWMWWCKPG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|