C30H37N — CID 143203824
N,4-dimethyl-N-phenylaniline;ethane;toluene (PubChem CID 143203824) has the molecular formula C30H37N and a molecular weight of 411.63 g/mol. Its IUPAC name is N,4-dimethyl-N-phenylaniline;ethane;toluene.
| Compound Name | N,4-dimethyl-N-phenylaniline;ethane;toluene |
|---|---|
| PubChem CID | 143203824 |
| Molecular Formula | C30H37N |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N,4-dimethyl-N-phenylaniline;ethane;toluene |
| SMILES | CC.Cc1ccc(N(C)c2ccccc2)cc1.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C14H15N.2C7H8.C2H6/c1-12-8-10-14(11-9-12)15(2)13-6-4-3-5-7-13;2*1-7-5-3-2-4-6-7;1-2/h3-11H,1-2H3;2*2-6H,1H3;1-2H3 |
| InChIKey | ATDOGCAHNWQJFA-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |