C17H12O — CID 134949933
[4-(4-phenylbuta-1,3-diynyl)phenyl]methanol (PubChem CID 134949933) has the molecular formula C17H12O and a molecular weight of 232.28 g/mol. Its IUPAC name is [4-(4-phenylbuta-1,3-diynyl)phenyl]methanol.
| Compound Name | [4-(4-phenylbuta-1,3-diynyl)phenyl]methanol |
|---|---|
| PubChem CID | 134949933 |
| Molecular Formula | C17H12O |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [4-(4-phenylbuta-1,3-diynyl)phenyl]methanol |
| SMILES | OCc1ccc(C#CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H12O/c18-14-17-12-10-16(11-13-17)9-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,10-13,18H,14H2 |
| InChIKey | ZYZAXQRLBXZBOG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|