C35H26IP — CID 154730921
triphenyl-[[4-(4-phenylbuta-1,3-diynyl)phenyl]methyl]phosphanium iodide (PubChem CID 154730921) has the molecular formula C35H26IP and a molecular weight of 604.47 g/mol. Its IUPAC name is triphenyl-[[4-(4-phenylbuta-1,3-diynyl)phenyl]methyl]phosphanium iodide.
| Compound Name | triphenyl-[[4-(4-phenylbuta-1,3-diynyl)phenyl]methyl]phosphanium iodide |
|---|---|
| PubChem CID | 154730921 |
| Molecular Formula | C35H26IP |
| Molecular Weight | 604.47 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | triphenyl-[[4-(4-phenylbuta-1,3-diynyl)phenyl]methyl]phosphanium iodide |
| SMILES | C(C#Cc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)#Cc1ccccc1.[I-] |
| InChI | InChI=1S/C35H26P.HI/c1-5-15-30(16-6-1)17-13-14-18-31-25-27-32(28-26-31)29-36(33-19-7-2-8-20-33,34-21-9-3-10-22-34)35-23-11-4-12-24-35;/h1-12,15-16,19-28H,29H2;1H/q+1;/p-1 |
| InChIKey | UUOLSGIFWSDQDZ-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|