About benzyl(triphenyl)phosphanium phenoxide
benzyl(triphenyl)phosphanium phenoxide (PubChem CID 18469640) has the molecular formula C31H27OP
and a molecular weight of 446.53 g/mol. Its IUPAC name is benzyl(triphenyl)phosphanium phenoxide.
Molecular Properties
| Compound Name | benzyl(triphenyl)phosphanium phenoxide |
| PubChem CID | 18469640 |
| Molecular Formula | C31H27OP |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | benzyl(triphenyl)phosphanium phenoxide |
| SMILES | [O-]c1ccccc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P.C6H6O/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;7-6-4-2-1-3-5-6/h1-20H,21H2;1-5,7H/q+1;/p-1 |
| InChIKey | PVXOJLLWTFSXQR-UHFFFAOYSA-M |
| XLogP | 5.94 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triphenyl)phosphanium phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triphenyl)phosphanium phenoxide?
The IUPAC name of benzyl(triphenyl)phosphanium phenoxide (CID 18469640) is benzyl(triphenyl)phosphanium phenoxide.
What is the SMILES notation for benzyl(triphenyl)phosphanium phenoxide?
The canonical SMILES for benzyl(triphenyl)phosphanium phenoxide is [O-]c1ccccc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzyl(triphenyl)phosphanium phenoxide?
The InChIKey is PVXOJLLWTFSXQR-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H22P.C6H6O/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;7-6-4-2-1-3-5-6/h1-20H,21H2;1-5,7H/q+1;/p-1.
What are the key properties of benzyl(triphenyl)phosphanium phenoxide?
benzyl(triphenyl)phosphanium phenoxide has a molecular weight of 446.53 g/mol, XLogP of 5.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triphenyl)phosphanium phenoxide is sourced from PubChem (CID 18469640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).