C25H21Cl2O4P — CID 71389118
(4-chlorophenyl)methyl-triphenylphosphanium perchlorate (PubChem CID 71389118) has the molecular formula C25H21Cl2O4P and a molecular weight of 487.32 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-triphenylphosphanium perchlorate.
| Compound Name | (4-chlorophenyl)methyl-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 71389118 |
| Molecular Formula | C25H21Cl2O4P |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | (4-chlorophenyl)methyl-triphenylphosphanium perchlorate |
| SMILES | Clc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H21ClP.ClHO4/c26-22-18-16-21(17-19-22)20-27(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25;2-1(3,4)5/h1-19H,20H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | UBQURETXPDTFSY-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|