C25H20BrF2P — CID 10790485
(3,4-difluorophenyl)methyl-triphenylphosphanium bromide (PubChem CID 10790485) has the molecular formula C25H20BrF2P and a molecular weight of 469.31 g/mol. Its IUPAC name is (3,4-difluorophenyl)methyl-triphenylphosphanium bromide.
| Compound Name | (3,4-difluorophenyl)methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 10790485 |
| Molecular Formula | C25H20BrF2P |
| Molecular Weight | 469.31 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | (3,4-difluorophenyl)methyl-triphenylphosphanium bromide |
| SMILES | Fc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1F.[Br-] |
| InChI | InChI=1S/C25H20F2P.BrH/c26-24-17-16-20(18-25(24)27)19-28(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23;/h1-18H,19H2;1H/q+1;/p-1 |
| InChIKey | FPNBDXVHCMGTHO-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|