C27H21F5P+ — CID 172686491
[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl-triphenylphosphanium (PubChem CID 172686491) has the molecular formula C27H21F5P+ and a molecular weight of 471.43 g/mol. Its IUPAC name is [4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl-triphenylphosphanium.
| Compound Name | [4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 172686491 |
| Molecular Formula | C27H21F5P+ |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl-triphenylphosphanium |
| SMILES | FC(F)(F)C(F)(F)c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21F5P/c28-26(29,27(30,31)32)22-18-16-21(17-19-22)20-33(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19H,20H2/q+1 |
| InChIKey | LFXNXGVYRVCQOI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|