C14H20OSi — CID 102468757
dimethyl-[(2S)-2-methylpenta-3,4-dienoxy]-phenylsilane (PubChem CID 102468757) has the molecular formula C14H20OSi and a molecular weight of 232.40 g/mol. Its IUPAC name is dimethyl-[(2S)-2-methylpenta-3,4-dienoxy]-phenylsilane.
| Compound Name | dimethyl-[(2S)-2-methylpenta-3,4-dienoxy]-phenylsilane |
|---|---|
| PubChem CID | 102468757 |
| Molecular Formula | C14H20OSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | dimethyl-[(2S)-2-methylpenta-3,4-dienoxy]-phenylsilane |
| SMILES | C=C=C[C@H](C)CO[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H20OSi/c1-5-9-13(2)12-15-16(3,4)14-10-7-6-8-11-14/h6-11,13H,1,12H2,2-4H3/t13-/m0/s1 |
| InChIKey | GNGTUHIIGVZQLX-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|