C12H14O — CID 102468732
[(2S)-penta-3,4-dien-2-yl]oxymethylbenzene (PubChem CID 102468732) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is [(2S)-penta-3,4-dien-2-yl]oxymethylbenzene.
| Compound Name | [(2S)-penta-3,4-dien-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 102468732 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | [(2S)-penta-3,4-dien-2-yl]oxymethylbenzene |
| SMILES | C=C=C[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-3-7-11(2)13-10-12-8-5-4-6-9-12/h4-9,11H,1,10H2,2H3/t11-/m0/s1 |
| InChIKey | WRADVJYZAPVUKJ-NSHDSACASA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |