C23H29BrOSi — CID 154718450
2-(bromomethyl)hexa-4,5-dienoxy-tert-butyl-diphenylsilane (PubChem CID 154718450) has the molecular formula C23H29BrOSi and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-(bromomethyl)hexa-4,5-dienoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-(bromomethyl)hexa-4,5-dienoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 154718450 |
| Molecular Formula | C23H29BrOSi |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-(bromomethyl)hexa-4,5-dienoxy-tert-butyl-diphenylsilane |
| SMILES | C=C=CCC(CBr)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29BrOSi/c1-5-6-13-20(18-24)19-25-26(23(2,3)4,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h6-12,14-17,20H,1,13,18-19H2,2-4H3 |
| InChIKey | XOBJXUNNMDTKBH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|