C39H44OPSi+ — CID 71726280
[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butyl]-triphenylphosphanium (PubChem CID 71726280) has the molecular formula C39H44OPSi+ and a molecular weight of 587.84 g/mol. Its IUPAC name is [(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butyl]-triphenylphosphanium.
| Compound Name | [(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 71726280 |
| Molecular Formula | C39H44OPSi+ |
| Molecular Weight | 587.84 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | [(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]butyl]-triphenylphosphanium |
| SMILES | CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H44OPSi/c1-5-33(31-40-42(39(2,3)4,37-27-17-9-18-28-37)38-29-19-10-20-30-38)32-41(34-21-11-6-12-22-34,35-23-13-7-14-24-35)36-25-15-8-16-26-36/h6-30,33H,5,31-32H2,1-4H3/q+1/t33-/m0/s1 |
| InChIKey | LEORLYRONGONNX-XIFFEERXSA-N |
| XLogP | 7.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.84 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|