C17H37BrO2Si2 — CID 10811490
[(E)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 10811490) has the molecular formula C17H37BrO2Si2 and a molecular weight of 409.56 g/mol. Its IUPAC name is [(E)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10811490 |
| Molecular Formula | C17H37BrO2Si2 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [(E)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C(/Br)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H37BrO2Si2/c1-16(2,3)21(7,8)19-13-11-15(18)12-14-20-22(9,10)17(4,5)6/h11H,12-14H2,1-10H3/b15-11+ |
| InChIKey | LCAAVSPIRKIHSH-RVDMUPIBSA-N |
| XLogP | 6.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|