C17H35ClO3Si2 — CID 10714716
[tert-butyl(dimethyl)silyl] (Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoate (PubChem CID 10714716) has the molecular formula C17H35ClO3Si2 and a molecular weight of 379.09 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoate |
|---|---|
| PubChem CID | 10714716 |
| Molecular Formula | C17H35ClO3Si2 |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (Z)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloropent-2-enoate |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C(Cl)=C/C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35ClO3Si2/c1-16(2,3)22(7,8)20-12-11-14(18)13-15(19)21-23(9,10)17(4,5)6/h13H,11-12H2,1-10H3/b14-13- |
| InChIKey | AHFCTEBSSLIUJC-YPKPFQOOSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|