C17H34O4Si2 — CID 91741643
bis[tert-butyl(dimethyl)silyl] (E)-2-methylbut-2-enedioate (PubChem CID 91741643) has the molecular formula C17H34O4Si2 and a molecular weight of 358.63 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] (E)-2-methylbut-2-enedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] (E)-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 91741643 |
| Molecular Formula | C17H34O4Si2 |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] (E)-2-methylbut-2-enedioate |
| SMILES | C/C(=C\C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O4Si2/c1-13(15(19)21-23(10,11)17(5,6)7)12-14(18)20-22(8,9)16(2,3)4/h12H,1-11H3/b13-12+ |
| InChIKey | HUKRUXTVYKXRNV-OUKQBFOZSA-N |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|