C13H23BrO3Si — CID 10925703
methyl (2Z,4E)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienoate (PubChem CID 10925703) has the molecular formula C13H23BrO3Si and a molecular weight of 335.31 g/mol. Its IUPAC name is methyl (2Z,4E)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienoate |
|---|---|
| PubChem CID | 10925703 |
| Molecular Formula | C13H23BrO3Si |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | methyl (2Z,4E)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienoate |
| SMILES | COC(=O)/C=C(/C=C/CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H23BrO3Si/c1-13(2,3)18(5,6)17-11(8-7-9-14)10-12(15)16-4/h7-8,10H,9H2,1-6H3/b8-7+,11-10- |
| InChIKey | IMUCSKNMNSBMBM-LFOHPMNASA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|