C20H32O4Si — CID 56850990
methyl (2E,4E,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,3S)-3-ethynyloxiran-2-yl]nona-2,4-dienoate (PubChem CID 56850990) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is methyl (2E,4E,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,3S)-3-ethynyloxiran-2-yl]nona-2,4-dienoate.
| Compound Name | methyl (2E,4E,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,3S)-3-ethynyloxiran-2-yl]nona-2,4-dienoate |
|---|---|
| PubChem CID | 56850990 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | methyl (2E,4E,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,3S)-3-ethynyloxiran-2-yl]nona-2,4-dienoate |
| SMILES | C#C[C@@H]1O[C@H]1[C@H](C)CC/C=C(\C=C\C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O4Si/c1-9-17-19(23-17)15(2)11-10-12-16(13-14-18(21)22-6)24-25(7,8)20(3,4)5/h1,12-15,17,19H,10-11H2,2-8H3/b14-13+,16-12+/t15-,17+,19+/m1/s1 |
| InChIKey | DTALEQNUPGHOAM-UDVUSDSVSA-N |
| XLogP | 4.44 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|