C24H40O5Si — CID 101265174
methyl (E)-3-[(2S,3R)-2-[(1E,3E,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-1,3-dienyl]-3-formyloxiran-2-yl]prop-2-enoate (PubChem CID 101265174) has the molecular formula C24H40O5Si and a molecular weight of 436.67 g/mol. Its IUPAC name is methyl (E)-3-[(2S,3R)-2-[(1E,3E,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-1,3-dienyl]-3-formyloxiran-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,3R)-2-[(1E,3E,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-1,3-dienyl]-3-formyloxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101265174 |
| Molecular Formula | C24H40O5Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | methyl (E)-3-[(2S,3R)-2-[(1E,3E,7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnona-1,3-dienyl]-3-formyloxiran-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@]1(/C=C/C(C)=C/CC[C@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[C@H]1C=O |
| InChI | InChI=1S/C24H40O5Si/c1-18(13-15-24(21(17-25)28-24)16-14-22(26)27-7)11-10-12-19(2)20(3)29-30(8,9)23(4,5)6/h11,13-17,19-21H,10,12H2,1-9H3/b15-13+,16-14+,18-11+/t19-,20+,21-,24-/m0/s1 |
| InChIKey | BPSWWBDVHSUMNE-VXHLPHSSSA-N |
| XLogP | 5.38 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|