C30H55BrO5Si — CID 57323008
methyl 7-[(1S,2R,3R)-3-acetyloxy-2-[(3S,4S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]cyclopentyl]hept-2-enoate (PubChem CID 57323008) has the molecular formula C30H55BrO5Si and a molecular weight of 603.76 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R)-3-acetyloxy-2-[(3S,4S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]cyclopentyl]hept-2-enoate.
| Compound Name | methyl 7-[(1S,2R,3R)-3-acetyloxy-2-[(3S,4S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]cyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57323008 |
| Molecular Formula | C30H55BrO5Si |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | methyl 7-[(1S,2R,3R)-3-acetyloxy-2-[(3S,4S)-2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]cyclopentyl]hept-2-enoate |
| SMILES | CCCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(Br)C[C@@H]1[C@@H](CCCCC=CC(=O)OC)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H55BrO5Si/c1-10-11-16-22(2)29(36-37(8,9)30(4,5)6)26(31)21-25-24(19-20-27(25)35-23(3)32)17-14-12-13-15-18-28(33)34-7/h15,18,22,24-27,29H,10-14,16-17,19-21H2,1-9H3/t22-,24-,25+,26?,27+,29-/m0/s1 |
| InChIKey | RPCQKMDSSGXZQZ-MGXQMJAXSA-N |
| XLogP | 8.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|