C18H38O4Si — CID 135016312
tert-butyl-[(1S,2R,3S)-2-(methoxymethoxy)-3-methyl-1-(oxiran-2-yl)heptoxy]-dimethylsilane (PubChem CID 135016312) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,3S)-2-(methoxymethoxy)-3-methyl-1-(oxiran-2-yl)heptoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R,3S)-2-(methoxymethoxy)-3-methyl-1-(oxiran-2-yl)heptoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135016312 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | tert-butyl-[(1S,2R,3S)-2-(methoxymethoxy)-3-methyl-1-(oxiran-2-yl)heptoxy]-dimethylsilane |
| SMILES | CCCC[C@H](C)[C@@H](OCOC)[C@H](O[Si](C)(C)C(C)(C)C)C1CO1 |
| InChI | InChI=1S/C18H38O4Si/c1-9-10-11-14(2)16(21-13-19-6)17(15-12-20-15)22-23(7,8)18(3,4)5/h14-17H,9-13H2,1-8H3/t14-,15?,16+,17+/m0/s1 |
| InChIKey | UXUXPZRDBDFCCX-ORBLICNNSA-N |
| XLogP | 4.59 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|