C18H38O6Si — CID 177389408
[(1R)-1,3-bis(methoxymethoxy)-4-methyl-1-[(2S)-oxiran-2-yl]pentan-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 177389408) has the molecular formula C18H38O6Si and a molecular weight of 378.58 g/mol. Its IUPAC name is [(1R)-1,3-bis(methoxymethoxy)-4-methyl-1-[(2S)-oxiran-2-yl]pentan-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-1,3-bis(methoxymethoxy)-4-methyl-1-[(2S)-oxiran-2-yl]pentan-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 177389408 |
| Molecular Formula | C18H38O6Si |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R)-1,3-bis(methoxymethoxy)-4-methyl-1-[(2S)-oxiran-2-yl]pentan-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOC(C(C)C)C(O[Si](C)(C)C(C)(C)C)[C@H](OCOC)[C@@H]1CO1 |
| InChI | InChI=1S/C18H38O6Si/c1-13(2)15(22-11-19-6)17(24-25(8,9)18(3,4)5)16(14-10-21-14)23-12-20-7/h13-17H,10-12H2,1-9H3/t14-,15?,16+,17?/m0/s1 |
| InChIKey | FQDNWILBGIFPIA-ORBLRFAASA-N |
| XLogP | 3.41 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|