C19H40O5Si — CID 56946984
[(2R,4S,6S)-2,6-bis(methoxymethoxy)non-8-en-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 56946984) has the molecular formula C19H40O5Si and a molecular weight of 376.61 g/mol. Its IUPAC name is [(2R,4S,6S)-2,6-bis(methoxymethoxy)non-8-en-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4S,6S)-2,6-bis(methoxymethoxy)non-8-en-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 56946984 |
| Molecular Formula | C19H40O5Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | [(2R,4S,6S)-2,6-bis(methoxymethoxy)non-8-en-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@H](C[C@H](C[C@@H](C)OCOC)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C19H40O5Si/c1-10-11-17(23-15-21-7)13-18(12-16(2)22-14-20-6)24-25(8,9)19(3,4)5/h10,16-18H,1,11-15H2,2-9H3/t16-,17+,18+/m1/s1 |
| InChIKey | YQBVTKFFGXWKMA-SQNIBIBYSA-N |
| XLogP | 4.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|