C17H38O5Si — CID 53235979
(2R,3S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2-methyloctane-1,3-diol (PubChem CID 53235979) has the molecular formula C17H38O5Si and a molecular weight of 350.57 g/mol. Its IUPAC name is (2R,3S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2-methyloctane-1,3-diol.
| Compound Name | (2R,3S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2-methyloctane-1,3-diol |
|---|---|
| PubChem CID | 53235979 |
| Molecular Formula | C17H38O5Si |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2R,3S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2-methyloctane-1,3-diol |
| SMILES | COCO[C@H](C)C[C@@H](C[C@H](O)[C@H](C)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O5Si/c1-13(11-18)16(19)10-15(9-14(2)21-12-20-6)22-23(7,8)17(3,4)5/h13-16,18-19H,9-12H2,1-8H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | QHMIMGLLWMOFKX-WCVJEAGWSA-N |
| XLogP | 3.16 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|