C13H28O3Si — CID 10978227
tert-butyl-[(2S,3R)-3-(methoxymethoxy)pent-4-en-2-yl]oxy-dimethylsilane (PubChem CID 10978227) has the molecular formula C13H28O3Si and a molecular weight of 260.45 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-3-(methoxymethoxy)pent-4-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R)-3-(methoxymethoxy)pent-4-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10978227 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | tert-butyl-[(2S,3R)-3-(methoxymethoxy)pent-4-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](OCOC)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O3Si/c1-9-12(15-10-14-6)11(2)16-17(7,8)13(3,4)5/h9,11-12H,1,10H2,2-8H3/t11-,12+/m0/s1 |
| InChIKey | MQPZZLQAJHOFJG-NWDGAFQWSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|