C20H44O5Si2 — CID 11611502
(2R,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(methoxymethoxy)hexanal (PubChem CID 11611502) has the molecular formula C20H44O5Si2 and a molecular weight of 420.74 g/mol. Its IUPAC name is (2R,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(methoxymethoxy)hexanal.
| Compound Name | (2R,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(methoxymethoxy)hexanal |
|---|---|
| PubChem CID | 11611502 |
| Molecular Formula | C20H44O5Si2 |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (2R,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(methoxymethoxy)hexanal |
| SMILES | COCO[C@@H](C=O)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O5Si2/c1-16(24-26(9,10)19(2,3)4)13-17(18(14-21)23-15-22-8)25-27(11,12)20(5,6)7/h14,16-18H,13,15H2,1-12H3/t16-,17-,18-/m0/s1 |
| InChIKey | BCHOEHAPUBKHDU-BZSNNMDCSA-N |
| XLogP | 5.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|