C22H42O5Si — CID 132582442
[(2R,6R)-6-(methoxymethoxy)oct-7-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate (PubChem CID 132582442) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is [(2R,6R)-6-(methoxymethoxy)oct-7-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate.
| Compound Name | [(2R,6R)-6-(methoxymethoxy)oct-7-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 132582442 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | [(2R,6R)-6-(methoxymethoxy)oct-7-en-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
| SMILES | C=CC[C@H](CC(=O)O[C@H](C)CCC[C@H](C=C)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O5Si/c1-10-13-20(27-28(8,9)22(4,5)6)16-21(23)26-18(3)14-12-15-19(11-2)25-17-24-7/h10-11,18-20H,1-2,12-17H2,3-9H3/t18-,19+,20-/m1/s1 |
| InChIKey | BACXGFUAHJNQBJ-HSALFYBXSA-N |
| XLogP | 5.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|