C13H24O5 — CID 56946981
(2R,6S)-2,6-bis(methoxymethoxy)non-8-en-4-one (PubChem CID 56946981) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R,6S)-2,6-bis(methoxymethoxy)non-8-en-4-one.
| Compound Name | (2R,6S)-2,6-bis(methoxymethoxy)non-8-en-4-one |
|---|---|
| PubChem CID | 56946981 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (2R,6S)-2,6-bis(methoxymethoxy)non-8-en-4-one |
| SMILES | C=CC[C@@H](CC(=O)C[C@@H](C)OCOC)OCOC |
| InChI | InChI=1S/C13H24O5/c1-5-6-13(18-10-16-4)8-12(14)7-11(2)17-9-15-3/h5,11,13H,1,6-10H2,2-4H3/t11-,13+/m1/s1 |
| InChIKey | SUUSPPNOBGMLJF-YPMHNXCESA-N |
| XLogP | 1.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|