C16H24O3 — CID 71496897
[(4R,6S)-6-(methoxymethoxy)hept-1-en-4-yl]oxymethylbenzene (PubChem CID 71496897) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is [(4R,6S)-6-(methoxymethoxy)hept-1-en-4-yl]oxymethylbenzene.
| Compound Name | [(4R,6S)-6-(methoxymethoxy)hept-1-en-4-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 71496897 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(4R,6S)-6-(methoxymethoxy)hept-1-en-4-yl]oxymethylbenzene |
| SMILES | C=CC[C@H](C[C@H](C)OCOC)OCc1ccccc1 |
| InChI | InChI=1S/C16H24O3/c1-4-8-16(11-14(2)19-13-17-3)18-12-15-9-6-5-7-10-15/h4-7,9-10,14,16H,1,8,11-13H2,2-3H3/t14-,16+/m0/s1 |
| InChIKey | LQFFKFKAGWGQDH-GOEBONIOSA-N |
| XLogP | 3.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|