C15H20O — CID 90067703
octa-1,7-dien-4-yloxymethylbenzene (PubChem CID 90067703) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is octa-1,7-dien-4-yloxymethylbenzene.
| Compound Name | octa-1,7-dien-4-yloxymethylbenzene |
|---|---|
| PubChem CID | 90067703 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | octa-1,7-dien-4-yloxymethylbenzene |
| SMILES | C=CCCC(CC=C)OCc1ccccc1 |
| InChI | InChI=1S/C15H20O/c1-3-5-12-15(9-4-2)16-13-14-10-7-6-8-11-14/h3-4,6-8,10-11,15H,1-2,5,9,12-13H2 |
| InChIKey | PUHZFRAZJSTTRK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|